cas: 1384265-30-8 — see every product listed under this CAS number, including other names
METHYL 1-(4-BROMOPHENYL)-4-OXOCYCLOHEXANECARBOXYLATE (CAS 1384265-30-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F303546-100MG |
| cas | 1384265-30-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 627.92 Pln | |
| Fluorochem | 250mg | 721.64 Pln | |
| Fluorochem | 1g | 1637.98 Pln | |
| Fluorochem | 5g | 4262.06 Pln | |
| Fluorochem | 10g | 7266.21 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 1-(4-bromophenyl)-4-oxocyclohexane-1-carboxylate (CAS 1384265-30-8) is a chemical compound with the molecular formula C14H15BrO3 and a molecular weight of 311.17 g/mol. IUPAC name: methyl 1-(4-bromophenyl)-4-oxocyclohexane-1-carboxylate. InChIKey: KWRSQQQEMTWZTI-UHFFFAOYSA-N.
| Molecular formula | C14H15BrO3 |
|---|---|
| Molecular weight | 311.17 g/mol |
| IUPAC name | methyl 1-(4-bromophenyl)-4-oxocyclohexane-1-carboxylate |
| InChIKey | KWRSQQQEMTWZTI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CCC(=O)CC1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)