cas: 1076198-49-6 — see every product listed under this CAS number, including other names
METHYL 5-AMINO-6-BROMOPYRAZINE-2-CARBOXYLATE, 98% (CAS 1076198-49-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F467783-100MG |
| cas | 1076198-49-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 247.85 Pln | |
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 1g | 763.29 Pln | |
| Fluorochem | 5g | 2481.44 Pln | |
| Fluorochem | 10g | 4543.21 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 5-amino-6-bromopyrazine-2-carboxylate (CAS 1076198-49-6) is a chemical compound with the molecular formula C6H6BrN3O2 and a molecular weight of 232.03 g/mol. IUPAC name: methyl 5-amino-6-bromopyrazine-2-carboxylate. InChIKey: MLSGAYHFWIBCSD-UHFFFAOYSA-N.
| Molecular formula | C6H6BrN3O2 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | methyl 5-amino-6-bromopyrazine-2-carboxylate |
| InChIKey | MLSGAYHFWIBCSD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=C(C(=N1)Br)N |
Computed by PubChem (NCBI)