cas: 110044-82-1 — see every product listed under this CAS number, including other names
MG-101, 98+%, 98+% (CAS 110044-82-1) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118VY5-10mg |
| cas | 110044-82-1 |
| size | 10mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 405.20 Pln | |
| Chemat | 25mg | 746.00 Pln | |
| Chemat | 50mg | 1086.80 Pln | |
| Chemat | 100mg | 1600.40 Pln | |
| Chemat | 250mg | 2368.40 Pln |
| purity | 98+% |
|---|---|
| delivery time | 3 weeks |
Acetylleucyl-leucyl-norleucinal is a tripeptide composed of N-acetylleucyl, leucyl and norleucinal residues joined in sequence. It has a role as a cysteine protease inhibitor. It is an aldehyde and a tripeptide.
Source: ChEBI
| Molecular formula | C20H37N3O4 |
|---|---|
| Molecular weight | 383.5 g/mol |
| IUPAC name | (2S)-2-acetamido-4-methyl-N-[(2S)-4-methyl-1-oxo-1-[[(2S)-1-oxohexan-2-yl]amino]pentan-2-yl]pentanamide |
| InChIKey | FMYKJLXRRQTBOR-BZSNNMDCSA-N |
| SMILES | CCCC[C@@H](C=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)C |
Computed by PubChem (NCBI)