cas: 1268882-43-4 — see every product listed under this CAS number, including other names
MK-1903, 98%, 98% (CAS 1268882-43-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EKUZ-1mg |
| cas | 1268882-43-4 |
| size | 1mg |
| availability | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 184.40 Pln | |
| Chemat | 5mg | 366.80 Pln | |
| Chemat | 10mg | 520.40 Pln | |
| Chemat | 25mg | 981.20 Pln | |
| Chemat | 50mg | 1365.20 Pln | |
| Chemat | 100mg | 1893.20 Pln | |
| Chemat | 250mg | 4566.80 Pln | |
| Chemat | 500mg | 6496.40 Pln | |
| Chemat | 1g | 9251.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2R,4R)-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxylic acid (CAS 1268882-43-4) is a chemical compound with the molecular formula C8H8N2O2 and a molecular weight of 164.16 g/mol. IUPAC name: (2R,4R)-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxylic acid. InChIKey: CUTZNERBKDMLAP-QWWZWVQMSA-N.
| Molecular formula | C8H8N2O2 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (2R,4R)-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxylic acid |
| InChIKey | CUTZNERBKDMLAP-QWWZWVQMSA-N |
| SMILES | C1[C@H]2[C@@H]1C3=C(C2)C(=NN3)C(=O)O |
Computed by PubChem (NCBI)