cas: 1140517-08-3 — see every product listed under this CAS number, including other names
ML604440 (CAS 1140517-08-3) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 10mM (in 1ml dmso), 25mg, 5mg, 50mg, 100mg, 200mg, 1mg. Offered by: GLPBio, Biosynth, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC61075-10 |
| cas | 1140517-08-3 |
| size | 10mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 2801.56 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 2085.44 Pln | |
| GLPBio | 25mg | 5188.61 Pln | |
| GLPBio | 5mg | 1930.98 Pln | |
| Biosynth | 25mg | price on request | |
| Biosynth | 50mg | price on request | |
| Chemat | 25mg | 4619.60 Pln | |
| Chemat | 50mg | 6222.80 Pln | |
| Chemat | 100mg | 8186.00 Pln | |
| Chemat | 200mg | 11219.60 Pln | |
| Chemat | 1mg | 798.80 Pln | |
| Chemat | 5mg | 2037.20 Pln | |
| Chemat | 10mg | 2982.80 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
[(1R)-3-methyl-1-[[2-methyl-2-[[2-(trifluoromethyl)benzoyl]amino]propanoyl]amino]butyl]boronic acid (CAS 1140517-08-3) is a chemical compound with the molecular formula C17H24BF3N2O4 and a molecular weight of 388.2 g/mol. IUPAC name: [(1R)-3-methyl-1-[[2-methyl-2-[[2-(trifluoromethyl)benzoyl]amino]propanoyl]amino]butyl]boronic acid. InChIKey: IRZZVDHGNHGNAI-ZDUSSCGKSA-N.
| Molecular formula | C17H24BF3N2O4 |
|---|---|
| Molecular weight | 388.2 g/mol |
| IUPAC name | [(1R)-3-methyl-1-[[2-methyl-2-[[2-(trifluoromethyl)benzoyl]amino]propanoyl]amino]butyl]boronic acid |
| InChIKey | IRZZVDHGNHGNAI-ZDUSSCGKSA-N |
| SMILES | B([C@H](CC(C)C)NC(=O)C(C)(C)NC(=O)C1=CC=CC=C1C(F)(F)F)(O)O |
Computed by PubChem (NCBI)