cas: 863971-12-4 — see every product listed under this CAS number, including other names
MMAF-OMe 99% (CAS 863971-12-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A700623-1mg |
| cas | 863971-12-4 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 225.75 Pln | |
| Ambeed | 5mg | 259.12 Pln | |
| Ambeed | 10mg | 337.00 Pln | |
| Ambeed | 25mg | 509.44 Pln | |
| Ambeed | 50mg | 681.88 Pln | |
| Ambeed | 100mg | 1215.88 Pln | |
| Ambeed | 250mg | 2929.12 Pln | |
| Ambeed | 1g | 9225.88 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A700623 |
Methyl (2S)-2-[[(2R,3R)-3-methoxy-3-[(2S)-1-[(3R,4S,5S)-3-methoxy-5-methyl-4-[methyl-[(2S)-3-methyl-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]butanoyl]amino]heptanoyl]pyrrolidin-2-yl]-2-methylpropanoyl]amino]-3-phenylpropanoate (CAS 863971-12-4) is a chemical compound with the molecular formula C40H67N5O8 and a molecular weight of 746.0 g/mol. IUPAC name: methyl (2S)-2-[[(2R,3R)-3-methoxy-3-[(2S)-1-[(3R,4S,5S)-3-methoxy-5-methyl-4-[methyl-[(2S)-3-methyl-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]butanoyl]amino]heptanoyl]pyrrolidin-2-yl]-2-methylpropanoyl]amino]-3-phenylpropanoate. InChIKey: WRVLBJXFSHALRZ-FUVGGWJZSA-N.
| Molecular formula | C40H67N5O8 |
|---|---|
| Molecular weight | 746.0 g/mol |
| IUPAC name | methyl (2S)-2-[[(2R,3R)-3-methoxy-3-[(2S)-1-[(3R,4S,5S)-3-methoxy-5-methyl-4-[methyl-[(2S)-3-methyl-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]butanoyl]amino]heptanoyl]pyrrolidin-2-yl]-2-methylpropanoyl]amino]-3-phenylpropanoate |
| InChIKey | WRVLBJXFSHALRZ-FUVGGWJZSA-N |
| SMILES | CC[C@H](C)[C@@H]([C@@H](CC(=O)N1CCC[C@H]1[C@@H]([C@@H](C)C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)OC)OC)OC)N(C)C(=O)[C@H](C(C)C)NC(=O)[C@H](C(C)C)NC |
Computed by PubChem (NCBI)