MPT0B390
cas: 1817802-18-8 — see every product listed under this CAS number, including other names
MPT0B390 (CAS 1817802-18-8) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg. Offered by: TargetMol, GLPBio, Chemat.
| brand | TargetMol |
|---|---|
| catalog number | T9963-1mg |
| cas | 1817802-18-8 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1mg | 565.03 Pln | |
| TargetMol | 5mg | 1129.62 Pln | |
| TargetMol | 10mg | 1601.41 Pln | |
| TargetMol | 25mg | 2577.43 Pln | |
| TargetMol | 50mg | 3586.98 Pln | |
| TargetMol | 100mg | 4815.66 Pln | |
| GLPBio | 10mg | 2310.10 Pln | |
| GLPBio | 25mg | 4416.33 Pln | |
| GLPBio | 5mg | 1678.24 Pln | |
| Chemat | 1mg | 299.60 Pln | |
| Chemat | 5mg | 659.60 Pln | |
| Chemat | 10mg | 962.00 Pln | |
| Chemat | 25mg | 1518.80 Pln | |
| Chemat | 50mg | 2070.80 Pln | |
| Chemat | 100mg | 2728.40 Pln |
properties
| purity | No data |
|---|---|
| delivery time | approx. 19 days |
(E)-N-hydroxy-3-[1-(4-methoxyphenyl)sulfonyl-2,3-dihydropyrrolo[2,3-b]pyridin-5-yl]prop-2-enamide (CAS 1817802-18-8) is a chemical compound with the molecular formula C17H17N3O5S and a molecular weight of 375.4 g/mol. IUPAC name: (E)-N-hydroxy-3-[1-(4-methoxyphenyl)sulfonyl-2,3-dihydropyrrolo[2,3-b]pyridin-5-yl]prop-2-enamide. InChIKey: QPXOAQWHONRALN-FARCUNLSSA-N.
| Molecular formula | C17H17N3O5S |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | (E)-N-hydroxy-3-[1-(4-methoxyphenyl)sulfonyl-2,3-dihydropyrrolo[2,3-b]pyridin-5-yl]prop-2-enamide |
| InChIKey | QPXOAQWHONRALN-FARCUNLSSA-N |
| SMILES | COC1=CC=C(C=C1)S(=O)(=O)N2CCC3=C2N=CC(=C3)/C=C/C(=O)NO |
Computed by PubChem (NCBI)
Synonyms:
orb1297771