cas: 2206736-04-9 — see every product listed under this CAS number, including other names
MRTX-1257, 99.71% (CAS 2206736-04-9) is a chemical reagent available from Chemat. Available pack sizes: 10mM/1mL, 10 mg, 5 mg, 50 mg, 25 mg, 100 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-114436-10mM/1mL |
| cas | 2206736-04-9 |
| size | 10mM/1mL |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 1169.54 Pln | |
| MedChemExpress | 10 mg | 1387.81 Pln | |
| MedChemExpress | 5 mg | 965.21 Pln | |
| MedChemExpress | 50 mg | 3421.88 Pln | |
| MedChemExpress | 25 mg | 2400.20 Pln | |
| MedChemExpress | 100 mg | 4907.96 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.71% |
2-[(2S)-4-[7-(8-methylnaphthalen-1-yl)-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile (CAS 2206736-04-9) is a chemical compound with the molecular formula C33H39N7O2 and a molecular weight of 565.7 g/mol. IUPAC name: 2-[(2S)-4-[7-(8-methylnaphthalen-1-yl)-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile. InChIKey: YRYQLVCTQFBRLD-UIOOFZCWSA-N.
| Molecular formula | C33H39N7O2 |
|---|---|
| Molecular weight | 565.7 g/mol |
| IUPAC name | 2-[(2S)-4-[7-(8-methylnaphthalen-1-yl)-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile |
| InChIKey | YRYQLVCTQFBRLD-UIOOFZCWSA-N |
| SMILES | CC1=C2C(=CC=C1)C=CC=C2N3CCC4=C(C3)N=C(N=C4N5CCN([C@H](C5)CC#N)C(=O)C=C)OC[C@@H]6CCCN6C |
Computed by PubChem (NCBI)