cas: 5698-98-6 — see every product listed under this CAS number, including other names
Magnesiumacrylate, 99%, 99% (CAS 5698-98-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 10g, 50g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114REF-5g |
| cas | 5698-98-6 |
| size | 5g |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 165.20 Pln | |
| Chemat | 25g | 371.60 Pln | |
| Chemat | 100g | 789.20 Pln | |
| Chemat | 500g | 2563.20 Pln | |
| Chemat | 10g | 227.60 Pln | |
| Chemat | 50g | 558.80 Pln | |
| Chemat | 250g | 1576.40 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
Magnesium bis(prop-2-enoate) (CAS 5698-98-6) is a chemical compound with the molecular formula C6H6MgO4 and a molecular weight of 166.41 g/mol. IUPAC name: magnesium bis(prop-2-enoate). InChIKey: DWLAVVBOGOXHNH-UHFFFAOYSA-L.
| Molecular formula | C6H6MgO4 |
|---|---|
| Molecular weight | 166.41 g/mol |
| IUPAC name | magnesium bis(prop-2-enoate) |
| InChIKey | DWLAVVBOGOXHNH-UHFFFAOYSA-L |
| SMILES | C=CC(=O)[O-].C=CC(=O)[O-].[Mg+2] |
Computed by PubChem (NCBI)