CAS 660843-23-2 appears in our catalog under these names: Mal–PEG2–NH2 TFA, Mal-PEG2-NH2 TFA 98%, Mal-PEG2-amine TFA salt, 98%, 98%, Mal-PEG2-NH2 (TFA), 99.37%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 50mg, 250mg, 1g, 50 mg, 100 mg.
1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]pyrrole-2,5-dione;2,2,2-trifluoroacetic acid (CAS 660843-23-2) is a chemical compound with the molecular formula C12H17F3N2O6 and a molecular weight of 342.27 g/mol. IUPAC name: 1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]pyrrole-2,5-dione;2,2,2-trifluoroacetic acid. InChIKey: WAOHORIEWBUISG-UHFFFAOYSA-N.
| Molecular formula | C12H17F3N2O6 |
|---|---|
| Molecular weight | 342.27 g/mol |
| IUPAC name | 1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]pyrrole-2,5-dione;2,2,2-trifluoroacetic acid |
| InChIKey | WAOHORIEWBUISG-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCOCCOCCN.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)