cas: 1415800-42-8 — see every product listed under this CAS number, including other names
Mal-PEG4-PFP, 95%, 95% (CAS 1415800-42-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112GLV-50mg |
| cas | 1415800-42-8 |
| size | 50mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 544.40 Pln | |
| Chemat | 100mg | 875.60 Pln | |
| Chemat | 250mg | 1446.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1415800-42-8) is a chemical compound with the molecular formula C21H22F5NO8 and a molecular weight of 511.4 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: XGSVXFAIAZKWST-UHFFFAOYSA-N.
| Molecular formula | C21H22F5NO8 |
|---|---|
| Molecular weight | 511.4 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | XGSVXFAIAZKWST-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCOCCOCCOCCOCCC(=O)OC2=C(C(=C(C(=C2F)F)F)F)F |
Computed by PubChem (NCBI)