cas: 1818294-46-0 — see every product listed under this CAS number, including other names
Mal-PEG8-Acid, 95%+, 95%+ (CAS 1818294-46-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I1BY-50mg |
| cas | 1818294-46-0 |
| size | 50mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 227.60 Pln | |
| Chemat | 100mg | 362.00 Pln | |
| Chemat | 250mg | 563.60 Pln | |
| Chemat | 1g | 1648.40 Pln | |
| Chemat | 5g | 6429.20 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
3-[2-[2-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1818294-46-0) is a chemical compound with the molecular formula C23H39NO12 and a molecular weight of 521.6 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: KLZPPWOSICDUKQ-UHFFFAOYSA-N.
| Molecular formula | C23H39NO12 |
|---|---|
| Molecular weight | 521.6 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | KLZPPWOSICDUKQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)