cas: 1807540-84-6 — see every product listed under this CAS number, including other names
Mal-amido-PEG4-TFP ester, 98% (CAS 1807540-84-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A755274-100mg |
| cas | 1807540-84-6 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 1176.70 Pln | |
| AmBeed | 1g | 3897.88 Pln | |
| Fluorochem | 250mg | 1112.13 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2,3,5,6-tetrafluorophenyl) 3-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1807540-84-6) is a chemical compound with the molecular formula C24H28F4N2O9 and a molecular weight of 564.5 g/mol. IUPAC name: (2,3,5,6-tetrafluorophenyl) 3-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: LKZRDWRFDOPKGN-UHFFFAOYSA-N.
| Molecular formula | C24H28F4N2O9 |
|---|---|
| Molecular weight | 564.5 g/mol |
| IUPAC name | (2,3,5,6-tetrafluorophenyl) 3-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | LKZRDWRFDOPKGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCC(=O)NCCOCCOCCOCCOCCC(=O)OC2=C(C(=CC(=C2F)F)F)F |
Computed by PubChem (NCBI)