cas: 1807512-46-4 — see every product listed under this CAS number, including other names
Mal-peg5-pfp 99% (CAS 1807512-46-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A754969-100mg |
| cas | 1807512-46-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 353.69 Pln | |
| Ambeed | 250mg | 637.38 Pln | |
| Ambeed | 1g | 1577.44 Pln | |
| Ambeed | 5g | 5415.56 Pln |
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A754969 |
(2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1807512-46-4) is a chemical compound with the molecular formula C23H26F5NO9 and a molecular weight of 555.4 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: HVQHYQSUANAJJW-UHFFFAOYSA-N.
| Molecular formula | C23H26F5NO9 |
|---|---|
| Molecular weight | 555.4 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | HVQHYQSUANAJJW-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCOCCOCCOCCOCCOCCC(=O)OC2=C(C(=C(C(=C2F)F)F)F)F |
Computed by PubChem (NCBI)