cas: 955094-26-5 — see every product listed under this CAS number, including other names
Maleimide-PEG2-NHS Ester, >98.0%(GC)(N) (CAS 955094-26-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | M3079-50MG |
| cas | 955094-26-5 |
| size | 50mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 50mg | 424.70 Pln | |
| TCI | 250mg | 1078.70 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(N) |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoate (CAS 955094-26-5) is a chemical compound with the molecular formula C18H23N3O9 and a molecular weight of 425.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoate. InChIKey: TZPDZOJURBVWHS-UHFFFAOYSA-N.
| Molecular formula | C18H23N3O9 |
|---|---|
| Molecular weight | 425.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoate |
| InChIKey | TZPDZOJURBVWHS-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCNC(=O)CCN2C(=O)C=CC2=O |
Computed by PubChem (NCBI)