CAS 1776112-90-3 appears in our catalog under these names: Mavelertinib, Mavelertinib/ 100%, PF 06747775, PF 06747775, 98%, 98%, Mavelertinib, 99.34%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 25mg, 100 mg, 5 mg, 10 mg.
N-[(3R,4R)-4-fluoro-1-[6-[(3-methoxy-1-methylpyrazol-4-yl)amino]-9-methylpurin-2-yl]pyrrolidin-3-yl]prop-2-enamide (CAS 1776112-90-3) is a chemical compound with the molecular formula C18H22FN9O2 and a molecular weight of 415.4 g/mol. IUPAC name: N-[(3R,4R)-4-fluoro-1-[6-[(3-methoxy-1-methylpyrazol-4-yl)amino]-9-methylpurin-2-yl]pyrrolidin-3-yl]prop-2-enamide. InChIKey: JYIUNVOCEFIUIU-GHMZBOCLSA-N.
| Molecular formula | C18H22FN9O2 |
|---|---|
| Molecular weight | 415.4 g/mol |
| IUPAC name | N-[(3R,4R)-4-fluoro-1-[6-[(3-methoxy-1-methylpyrazol-4-yl)amino]-9-methylpurin-2-yl]pyrrolidin-3-yl]prop-2-enamide |
| InChIKey | JYIUNVOCEFIUIU-GHMZBOCLSA-N |
| SMILES | CN1C=C(C(=N1)OC)NC2=C3C(=NC(=N2)N4C[C@H]([C@@H](C4)F)NC(=O)C=C)N(C=N3)C |
Computed by PubChem (NCBI)