cas: 3685-84-5 — see every product listed under this CAS number, including other names
Meclofenoxate Hydrochloride, >98.0%(T) (CAS 3685-84-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | M2460-1G |
| cas | 3685-84-5 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 98.68 Pln | |
| TCI | 5g | 300.28 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
2-(dimethylamino)ethyl 2-(4-chlorophenoxy)acetate;hydrochloride (CAS 3685-84-5) is a chemical compound with the molecular formula C12H17Cl2NO3 and a molecular weight of 294.17 g/mol. IUPAC name: 2-(dimethylamino)ethyl 2-(4-chlorophenoxy)acetate;hydrochloride. InChIKey: FIVHOHCAXWQPGC-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl2NO3 |
|---|---|
| Molecular weight | 294.17 g/mol |
| IUPAC name | 2-(dimethylamino)ethyl 2-(4-chlorophenoxy)acetate;hydrochloride |
| InChIKey | FIVHOHCAXWQPGC-UHFFFAOYSA-N |
| SMILES | CN(C)CCOC(=O)COC1=CC=C(C=C1)Cl.Cl |
Computed by PubChem (NCBI)