cas: 2124-57-4 — see every product listed under this CAS number, including other names
Menaquinone-7 98% (CAS 2124-57-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A532004-10g |
| cas | 2124-57-4 |
| size | 10g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 23410.25 Pln | |
| Ambeed | 1mg | 164.56 Pln | |
| Ambeed | 5mg | 248.00 Pln | |
| Ambeed | 10mg | 309.19 Pln | |
| Ambeed | 25mg | 509.44 Pln | |
| Ambeed | 50mg | 681.88 Pln | |
| Ambeed | 100mg | 1010.06 Pln | |
| Ambeed | 250mg | 1655.31 Pln | |
| Ambeed | 1g | 4241.88 Pln | |
| Ambeed | 5g | 14654.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A532004 |
Menaquinone-7 is a menaquinone whose side-chain contains seven isoprene units in an all-trans-configutation. It has a role as a Mycoplasma genitalium metabolite, a cofactor, a bone density conservation agent, an Escherichia coli metabolite and a human blood serum metabolite.
Source: ChEBI
| Molecular formula | C46H64O2 |
|---|---|
| Molecular weight | 649.0 g/mol |
| IUPAC name | 2-[(2E,6E,10E,14E,18E,22E)-3,7,11,15,19,23,27-heptamethyloctacosa-2,6,10,14,18,22,26-heptaenyl]-3-methylnaphthalene-1,4-dione |
| InChIKey | RAKQPZMEYJZGPI-LJWNYQGCSA-N |
| SMILES | CC1=C(C(=O)C2=CC=CC=C2C1=O)C/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CCC=C(C)C |
Computed by PubChem (NCBI)