Mesityl(p-tolyl)iodonium tetrafluoroborate, 97%
cas: 855516-31-3 — see every product listed under this CAS number, including other names
Mesityl(p-tolyl)iodonium tetrafluoroborate, 97% (CAS 855516-31-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 250mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1508778-1g |
| cas | 855516-31-3 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 286.94 Pln | |
| Ambeed | 5g | 798.69 Pln | |
| Ambeed | 10g | 1238.12 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 294.80 Pln | |
| Chemat | 5g | 875.60 Pln | |
| BLDpharm | 250mg | 147.75 Pln | |
| BLDpharm | 1g | 297.70 Pln | |
| BLDpharm | 5g | 858.61 Pln | |
| BLDpharm | 10g | 1330.67 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(4-methylphenyl)-(2,4,6-trimethylphenyl)iodanium tetrafluoroborate (CAS 855516-31-3) is a chemical compound with the molecular formula C16H18BF4I and a molecular weight of 424.0 g/mol. IUPAC name: (4-methylphenyl)-(2,4,6-trimethylphenyl)iodanium tetrafluoroborate. InChIKey: LHWJLNWENDSGFA-UHFFFAOYSA-N.
| Molecular formula | C16H18BF4I |
|---|---|
| Molecular weight | 424.0 g/mol |
| IUPAC name | (4-methylphenyl)-(2,4,6-trimethylphenyl)iodanium tetrafluoroborate |
| InChIKey | LHWJLNWENDSGFA-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.CC1=CC=C(C=C1)[I+]C2=C(C=C(C=C2C)C)C |
Computed by PubChem (NCBI)