cas: 1539817-33-8 — see every product listed under this CAS number, including other names
Methanone, (2-amino-4-bromophenyl)[4-(methylsulfonyl)-1-piperazinyl]-, 95%, 95% (CAS 1539817-33-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IMPY-250mg |
| cas | 1539817-33-8 |
| size | 250mg |
| availability | 6.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 890.00 Pln | |
| Chemat | 1g | 2128.40 Pln | |
| Chemat | 5g | 5574.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2-amino-4-bromophenyl)-(4-methylsulfonylpiperazin-1-yl)methanone (CAS 1539817-33-8) is a chemical compound with the molecular formula C12H16BrN3O3S and a molecular weight of 362.25 g/mol. IUPAC name: (2-amino-4-bromophenyl)-(4-methylsulfonylpiperazin-1-yl)methanone. InChIKey: MLGGEWPEPQQPAJ-UHFFFAOYSA-N.
| Molecular formula | C12H16BrN3O3S |
|---|---|
| Molecular weight | 362.25 g/mol |
| IUPAC name | (2-amino-4-bromophenyl)-(4-methylsulfonylpiperazin-1-yl)methanone |
| InChIKey | MLGGEWPEPQQPAJ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCN(CC1)C(=O)C2=C(C=C(C=C2)Br)N |
Computed by PubChem (NCBI)