cas: 1807530-04-6 — see every product listed under this CAS number, including other names
Methoxycarbonyl-peg5-t-butyl ester 98% (CAS 1807530-04-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A754751-100mg |
| cas | 1807530-04-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 609.56 Pln | |
| Ambeed | 250mg | 1293.75 Pln | |
| Ambeed | 1g | 3607.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A754751 |
Methyl 3-[2-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1807530-04-6) is a chemical compound with the molecular formula C19H36O9 and a molecular weight of 408.5 g/mol. IUPAC name: methyl 3-[2-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: BJNQNORQYFJOCD-UHFFFAOYSA-N.
| Molecular formula | C19H36O9 |
|---|---|
| Molecular weight | 408.5 g/mol |
| IUPAC name | methyl 3-[2-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | BJNQNORQYFJOCD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCC(=O)OC |
Computed by PubChem (NCBI)