cas: 630421-45-3 — see every product listed under this CAS number, including other names
Methyl (2S,4R)-1-[(2S)-2-{[(tert-butoxy)carbonyl]amino}-3,3-dimethylbutanoyl]-4-hydroxypyrrolidine-2-carboxylate, 95%+, 95%+ (CAS 630421-45-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12UO56-100mg |
| cas | 630421-45-3 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 366.80 Pln | |
| Chemat | 1g | 544.40 Pln | |
| Chemat | 5g | 1096.40 Pln | |
| Chemat | 10g | 1782.80 Pln | |
| Chemat | 25g | 3506.00 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
Methyl (2S,4R)-1-[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-4-hydroxypyrrolidine-2-carboxylate (CAS 630421-45-3) is a chemical compound with the molecular formula C17H30N2O6 and a molecular weight of 358.4 g/mol. IUPAC name: methyl (2S,4R)-1-[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-4-hydroxypyrrolidine-2-carboxylate. InChIKey: YJSDCJXQCWZQGU-GRYCIOLGSA-N.
| Molecular formula | C17H30N2O6 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | methyl (2S,4R)-1-[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-4-hydroxypyrrolidine-2-carboxylate |
| InChIKey | YJSDCJXQCWZQGU-GRYCIOLGSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)N1C[C@@H](C[C@H]1C(=O)OC)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)