cas: 91-09-8 — see every product listed under this CAS number, including other names
Methyl α-D-xylopyranoside, 98%, 98% (CAS 91-09-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GT7Y-1g |
| cas | 91-09-8 |
| size | 1g |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 563.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S,3R,4S,5R)-2-methoxyoxane-3,4,5-triol (CAS 91-09-8) is a chemical compound with the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. IUPAC name: (2S,3R,4S,5R)-2-methoxyoxane-3,4,5-triol. InChIKey: ZBDGHWFPLXXWRD-MOJAZDJTSA-N.
| Molecular formula | C6H12O5 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (2S,3R,4S,5R)-2-methoxyoxane-3,4,5-triol |
| InChIKey | ZBDGHWFPLXXWRD-MOJAZDJTSA-N |
| SMILES | CO[C@@H]1[C@@H]([C@H]([C@@H](CO1)O)O)O |
Computed by PubChem (NCBI)