cas: 1385694-79-0 — see every product listed under this CAS number, including other names
Methyl 1-(3-Bromophenyl)-4-oxocyclohexanecarboxylate, >95%, >95% (CAS 1385694-79-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1129R7-100mg |
| cas | 1385694-79-0 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 443.60 Pln | |
| Chemat | 250mg | 510.80 Pln | |
| Chemat | 1g | 1130.00 Pln | |
| Chemat | 5g | 2819.60 Pln | |
| Chemat | 10g | 4197.20 Pln | |
| Chemat | 25g | 8334.80 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
Methyl 1-(3-bromophenyl)-4-oxocyclohexane-1-carboxylate (CAS 1385694-79-0) is a chemical compound with the molecular formula C14H15BrO3 and a molecular weight of 311.17 g/mol. IUPAC name: methyl 1-(3-bromophenyl)-4-oxocyclohexane-1-carboxylate. InChIKey: YPBHRRTXSHSEHE-UHFFFAOYSA-N.
| Molecular formula | C14H15BrO3 |
|---|---|
| Molecular weight | 311.17 g/mol |
| IUPAC name | methyl 1-(3-bromophenyl)-4-oxocyclohexane-1-carboxylate |
| InChIKey | YPBHRRTXSHSEHE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CCC(=O)CC1)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)