cas: 1325206-78-7 — see every product listed under this CAS number, including other names
Methyl 2-((4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)amino)benzoate, 95%, 95% (CAS 1325206-78-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FFY7-250mg |
| cas | 1325206-78-7 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 942.80 Pln | |
| Chemat | 1g | 1854.80 Pln | |
| Chemat | 5g | 5714.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylamino]benzoate (CAS 1325206-78-7) is a chemical compound with the molecular formula C21H26BNO4 and a molecular weight of 367.2 g/mol. IUPAC name: methyl 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylamino]benzoate. InChIKey: XPZGMGASWMQGPB-UHFFFAOYSA-N.
| Molecular formula | C21H26BNO4 |
|---|---|
| Molecular weight | 367.2 g/mol |
| IUPAC name | methyl 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylamino]benzoate |
| InChIKey | XPZGMGASWMQGPB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CNC3=CC=CC=C3C(=O)OC |
Computed by PubChem (NCBI)