cas: 873846-89-0 — see every product listed under this CAS number, including other names
Methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)benzoate, 98%, 98% (CAS 873846-89-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JWVL-10g |
| cas | 873846-89-0 |
| size | 10g |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 7149.20 Pln | |
| Chemat | 50mg | 150.80 Pln | |
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 309.20 Pln | |
| Chemat | 1g | 808.40 Pln | |
| Chemat | 5g | 3789.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)benzoate (CAS 873846-89-0) is a chemical compound with the molecular formula C15H18BF3O4 and a molecular weight of 330.11 g/mol. IUPAC name: methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)benzoate. InChIKey: SIWNNYVLNBGRQK-UHFFFAOYSA-N.
| Molecular formula | C15H18BF3O4 |
|---|---|
| Molecular weight | 330.11 g/mol |
| IUPAC name | methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)benzoate |
| InChIKey | SIWNNYVLNBGRQK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C(F)(F)F)C(=O)OC |
Computed by PubChem (NCBI)