cas: 1245708-05-7 — see every product listed under this CAS number, including other names
Methyl 2-(4-(4-hydroxyphenyl)cyclohexyl)acetate, 98% (CAS 1245708-05-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A803185-5g |
| cas | 1245708-05-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 18063.64 Pln | |
| Fluorochem | 100mg | 529.00 Pln | |
| Fluorochem | 250mg | 846.59 Pln | |
| Fluorochem | 1g | 1632.78 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 2-[4-(4-hydroxyphenyl)cyclohexyl]acetate (CAS 1245708-05-7) is a chemical compound with the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. IUPAC name: methyl 2-[4-(4-hydroxyphenyl)cyclohexyl]acetate. InChIKey: WTNQUMAHFJRBGX-UHFFFAOYSA-N.
| Molecular formula | C15H20O3 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | methyl 2-[4-(4-hydroxyphenyl)cyclohexyl]acetate |
| InChIKey | WTNQUMAHFJRBGX-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1CCC(CC1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)