cas: 1193387-88-0 — see every product listed under this CAS number, including other names
Methyl 2-(4-amino-1H-pyrazol-1-yl)acetate dihydrochloride, 95+%, 95+% (CAS 1193387-88-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111ILW-100mg |
| cas | 1193387-88-0 |
| size | 100mg |
| availability | 1.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 582.80 Pln | |
| Chemat | 250mg | 842.00 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-(4-aminopyrazol-1-yl)acetate;dihydrochloride (CAS 1193387-88-0) is a chemical compound with the molecular formula C6H11Cl2N3O2 and a molecular weight of 228.07 g/mol. IUPAC name: methyl 2-(4-aminopyrazol-1-yl)acetate;dihydrochloride. InChIKey: VGPNGONDCIEPIW-UHFFFAOYSA-N.
| Molecular formula | C6H11Cl2N3O2 |
|---|---|
| Molecular weight | 228.07 g/mol |
| IUPAC name | methyl 2-(4-aminopyrazol-1-yl)acetate;dihydrochloride |
| InChIKey | VGPNGONDCIEPIW-UHFFFAOYSA-N |
| SMILES | COC(=O)CN1C=C(C=N1)N.Cl.Cl |
Computed by PubChem (NCBI)