cas: 756813-88-4 — see every product listed under this CAS number, including other names
Methyl 2-(4-amino-3-iodophenyl)-2-methylpropanoate (CAS 756813-88-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G8LA-50mg |
| cas | 756813-88-4 |
| size | 50mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 160.40 Pln | |
| Chemat | 250mg | 338.00 Pln | |
| Chemat | 1g | 582.80 Pln |
| delivery time | 3 weeks |
|---|
Methyl 2-(4-amino-3-iodophenyl)-2-methylpropanoate (CAS 756813-88-4) is a chemical compound with the molecular formula C11H14INO2 and a molecular weight of 319.14 g/mol. IUPAC name: methyl 2-(4-amino-3-iodophenyl)-2-methylpropanoate. InChIKey: UETQLYCUPBNAJN-UHFFFAOYSA-N.
| Molecular formula | C11H14INO2 |
|---|---|
| Molecular weight | 319.14 g/mol |
| IUPAC name | methyl 2-(4-amino-3-iodophenyl)-2-methylpropanoate |
| InChIKey | UETQLYCUPBNAJN-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=C(C=C1)N)I)C(=O)OC |
Computed by PubChem (NCBI)