Methyl 2-amino-6-chloroisonicotinate, 97%
cas: 1005508-80-4 — see every product listed under this CAS number, including other names
Methyl 2-amino-6-chloroisonicotinate, 97% (CAS 1005508-80-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A560920-100mg |
| cas | 1005508-80-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 359.25 Pln | |
| Ambeed | 250mg | 492.75 Pln | |
| Ambeed | 1g | 1182.50 Pln | |
| Ambeed | 5g | 3401.94 Pln | |
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 280.40 Pln | |
| Chemat | 1g | 736.40 Pln | |
| Chemat | 5g | 2128.40 Pln | |
| Chemat | 10g | 3165.20 Pln | |
| BLDpharm | 100mg | 386.56 Pln | |
| BLDpharm | 250mg | 525.40 Pln | |
| BLDpharm | 1g | 1269.58 Pln | |
| BLDpharm | 5g | 3663.18 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 2-amino-6-chloropyridine-4-carboxylate (CAS 1005508-80-4) is a chemical compound with the molecular formula C7H7ClN2O2 and a molecular weight of 186.59 g/mol. IUPAC name: methyl 2-amino-6-chloropyridine-4-carboxylate. InChIKey: MYBUXYUDDLFCPJ-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O2 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | methyl 2-amino-6-chloropyridine-4-carboxylate |
| InChIKey | MYBUXYUDDLFCPJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NC(=C1)Cl)N |
Computed by PubChem (NCBI)
