cas: 306935-33-1 — see every product listed under this CAS number, including other names
Methyl 2-chloro-4,4-dimethyl-3-oxopentanoate, 95%, 95% (CAS 306935-33-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1141UK-100mg |
| cas | 306935-33-1 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 366.80 Pln | |
| Chemat | 250mg | 616.40 Pln | |
| Chemat | 500mg | 933.20 Pln | |
| Chemat | 1g | 1446.80 Pln | |
| Chemat | 5g | 4173.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-chloro-4,4-dimethyl-3-oxopentanoate (CAS 306935-33-1) is a chemical compound with the molecular formula C8H13ClO3 and a molecular weight of 192.64 g/mol. IUPAC name: methyl 2-chloro-4,4-dimethyl-3-oxopentanoate. InChIKey: NGRPVOKPBYTXLT-UHFFFAOYSA-N.
| Molecular formula | C8H13ClO3 |
|---|---|
| Molecular weight | 192.64 g/mol |
| IUPAC name | methyl 2-chloro-4,4-dimethyl-3-oxopentanoate |
| InChIKey | NGRPVOKPBYTXLT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C(C(=O)OC)Cl |
Computed by PubChem (NCBI)