cas: 10399-13-0 — see every product listed under this CAS number, including other names
Methyl 2-cyclohexyl-2-hydroxy-2-phenylacetate, 98%, 98% (CAS 10399-13-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HA9W-1g |
| cas | 10399-13-0 |
| size | 1g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 208.40 Pln | |
| Chemat | 25g | 582.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-cyclohexyl-2-hydroxy-2-phenylacetate (CAS 10399-13-0) is a chemical compound with the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. IUPAC name: methyl 2-cyclohexyl-2-hydroxy-2-phenylacetate. InChIKey: SPTZOODMHSABLY-UHFFFAOYSA-N.
| Molecular formula | C15H20O3 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | methyl 2-cyclohexyl-2-hydroxy-2-phenylacetate |
| InChIKey | SPTZOODMHSABLY-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1CCCCC1)(C2=CC=CC=C2)O |
Computed by PubChem (NCBI)