cas: 877399-11-6 — see every product listed under this CAS number, including other names
Methyl 2-methyl-2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)propanoate 98% (CAS 877399-11-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1162370-100mg |
| cas | 877399-11-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 437.12 Pln | |
| Ambeed | 250mg | 670.75 Pln | |
| Ambeed | 1g | 1694.25 Pln | |
| Ambeed | 5g | 5048.44 Pln | |
| Ambeed | 10g | 8474.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1162370 |
Methyl 2-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propanoate (CAS 877399-11-6) is a chemical compound with the molecular formula C14H23BN2O4 and a molecular weight of 294.16 g/mol. IUPAC name: methyl 2-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propanoate. InChIKey: YRXGPNAUFJPKRO-UHFFFAOYSA-N.
| Molecular formula | C14H23BN2O4 |
|---|---|
| Molecular weight | 294.16 g/mol |
| IUPAC name | methyl 2-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propanoate |
| InChIKey | YRXGPNAUFJPKRO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)C(C)(C)C(=O)OC |
Computed by PubChem (NCBI)