cas: 1093307-33-5 — see every product listed under this CAS number, including other names
Methyl 3-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)propanoate, 95% (CAS 1093307-33-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F223537-100MG |
| cas | 1093307-33-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 346.77 Pln | |
| Fluorochem | 250mg | 560.24 Pln | |
| Fluorochem | 1g | 1309.97 Pln | |
| Fluorochem | 5g | 4111.07 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propanoate (CAS 1093307-33-5) is a chemical compound with the molecular formula C13H21BN2O4 and a molecular weight of 280.13 g/mol. IUPAC name: methyl 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propanoate. InChIKey: VDPXXMZHTGSNBL-UHFFFAOYSA-N.
| Molecular formula | C13H21BN2O4 |
|---|---|
| Molecular weight | 280.13 g/mol |
| IUPAC name | methyl 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propanoate |
| InChIKey | VDPXXMZHTGSNBL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CCC(=O)OC |
Computed by PubChem (NCBI)