cas: 1219200-16-4 — see every product listed under this CAS number, including other names
Methyl 3-bromo-2-((tert-butoxycarbonyl)amino)propanoate, 98% (CAS 1219200-16-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A437666-5g |
| cas | 1219200-16-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 10186.54 Pln | |
| Fluorochem | 100mg | 502.97 Pln | |
| Fluorochem | 250mg | 799.74 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 3-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 1219200-16-4) is a chemical compound with the molecular formula C9H16BrNO4 and a molecular weight of 282.13 g/mol. IUPAC name: methyl 3-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: ODLDPRMMKCMNMD-UHFFFAOYSA-N.
| Molecular formula | C9H16BrNO4 |
|---|---|
| Molecular weight | 282.13 g/mol |
| IUPAC name | methyl 3-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | ODLDPRMMKCMNMD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CBr)C(=O)OC |
Computed by PubChem (NCBI)