cas: 859063-65-3 — see every product listed under this CAS number, including other names
Methyl 3-chloro-5-methylpyrazine-2-carboxylate, 95%, 95% (CAS 859063-65-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119G7N-100mg |
| cas | 859063-65-3 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 390.80 Pln | |
| Chemat | 250mg | 616.40 Pln | |
| Chemat | 1g | 1557.20 Pln | |
| Chemat | 5g | 6635.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-chloro-5-methylpyrazine-2-carboxylate (CAS 859063-65-3) is a chemical compound with the molecular formula C7H7ClN2O2 and a molecular weight of 186.59 g/mol. IUPAC name: methyl 3-chloro-5-methylpyrazine-2-carboxylate. InChIKey: PCXXNIDVYAIUHR-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O2 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | methyl 3-chloro-5-methylpyrazine-2-carboxylate |
| InChIKey | PCXXNIDVYAIUHR-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(C(=N1)Cl)C(=O)OC |
Computed by PubChem (NCBI)