Methyl 4-(1-hydroxyethyl)benzoate, 95%
cas: 84851-56-9 — see every product listed under this CAS number, including other names
Methyl 4-(1-hydroxyethyl)benzoate, 95% (CAS 84851-56-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg. Offered by: Combi-blocks, Ambeed, BLDpharm, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | QK-1539-250mg |
| cas | 84851-56-9 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 5g | price on request | |
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 704.12 Pln | |
| Ambeed | 10g | 1182.50 Pln | |
| Ambeed | 25g | 2612.06 Pln | |
| BLDpharm | 100mg | 236.61 Pln | |
| BLDpharm | 250mg | 269.93 Pln | |
| BLDpharm | 1g | 308.80 Pln | |
| BLDpharm | 5g | 753.09 Pln | |
| BLDpharm | 10g | 1269.58 Pln | |
| BLDpharm | 25g | 2807.92 Pln | |
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 213.20 Pln | |
| Chemat | 1g | 434.00 Pln | |
| Chemat | 5g | 1634.00 Pln | |
| Chemat | 10g | 2680.40 Pln | |
| Chemat | 25g | 5824.40 Pln | |
| Fluorochem | 100mg | 211.40 Pln | |
| Fluorochem | 250mg | 242.64 Pln | |
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 1153.78 Pln | |
| Fluorochem | 10g | 2236.73 Pln | |
| Fluorochem | 25g | 5433.52 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Methyl 4-(1-hydroxyethyl)benzoate (CAS 84851-56-9) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: methyl 4-(1-hydroxyethyl)benzoate. InChIKey: KAXLTAULVFFCNL-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | methyl 4-(1-hydroxyethyl)benzoate |
| InChIKey | KAXLTAULVFFCNL-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)C(=O)OC)O |
Computed by PubChem (NCBI)
Synonyms:
Methyl 4-(1-hydroxyethyl)benzoate, 4-(1-hydroxyethyl)benzoic acid methyl ester, Benzoic acid, 4-(1-hydroxyethyl)-, methyl ester, 4-(1-hydroxy-ethyl)-benzoic acid methyl ester, methyl-4-(1-hydroxyethyl)benzoate, Methyl 4-(1-hydroxyethyl), methyl 4-(hydroxyethyl)benzoate, Methyl 4-(1-hydroxyethyl)benzoate #, racemic methyl 4-(1-hydroxyethyl)benzoate