cas: 1045795-70-7 — see every product listed under this CAS number, including other names
Methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzoate, 97% (CAS 1045795-70-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F464504-100MG |
| cas | 1045795-70-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 96.86 Pln | |
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 320.74 Pln | |
| Fluorochem | 5g | 1216.26 Pln | |
| Fluorochem | 25g | 4137.10 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzoate (CAS 1045795-70-7) is a chemical compound with the molecular formula C15H18BF3O4 and a molecular weight of 330.11 g/mol. IUPAC name: methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzoate. InChIKey: FKZBIAASSSCFDM-UHFFFAOYSA-N.
| Molecular formula | C15H18BF3O4 |
|---|---|
| Molecular weight | 330.11 g/mol |
| IUPAC name | methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzoate |
| InChIKey | FKZBIAASSSCFDM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C(=O)OC)C(F)(F)F |
Computed by PubChem (NCBI)