Methyl 4-ethynylbenzoate, 98%
cas: 3034-86-4 — see every product listed under this CAS number, including other names
Methyl 4-ethynylbenzoate, 98% (CAS 3034-86-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 100mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A245615-250mg |
| cas | 3034-86-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 225.75 Pln | |
| Ambeed | 10g | 236.88 Pln | |
| Ambeed | 25g | 420.44 Pln | |
| Ambeed | 100g | 1421.69 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 208.84 Pln | |
| BLDpharm | 1g | 236.61 Pln | |
| BLDpharm | 5g | 269.93 Pln | |
| BLDpharm | 10g | 308.80 Pln | |
| BLDpharm | 25g | 447.64 Pln | |
| BLDpharm | 100g | 1525.04 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 4-ethynylbenzoate (CAS 3034-86-4) is a chemical compound with the molecular formula C10H8O2 and a molecular weight of 160.17 g/mol. IUPAC name: methyl 4-ethynylbenzoate. InChIKey: JPGRSTBIEYGVNO-UHFFFAOYSA-N.
| Molecular formula | C10H8O2 |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | methyl 4-ethynylbenzoate |
| InChIKey | JPGRSTBIEYGVNO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C#C |
Computed by PubChem (NCBI)
Synonyms:
methyl 4-ethynylbenzoate, benzoic acid, 4-ethynyl-, methyl ester, InChI=1/C10H8O2/c1-3-8-4-6-9(7-5-8)10(11)12-2/h1,4-7H,2H, 4-Ethynylbenzoic acid methyl ester, methyl4-ethynylbenzoate, Methyl 4-ethynyl-benzoate, Benzoic acid,4-ethynyl-,methyl ester, 4-Ethynylbenzoi, 4-ethinylbenzoic acid methyl ester, Methyl 4-ethynylbenzoate, >=90%