cas: 1218790-17-0 — see every product listed under this CAS number, including other names
Methyl 4-fluoro-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate 98% (CAS 1218790-17-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A277025-100mg |
| cas | 1218790-17-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 409.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A277025 |
Methyl 4-fluoro-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1218790-17-0) is a chemical compound with the molecular formula C15H20BFO4 and a molecular weight of 294.13 g/mol. IUPAC name: methyl 4-fluoro-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: DRYMURGWBFWGPH-UHFFFAOYSA-N.
| Molecular formula | C15H20BFO4 |
|---|---|
| Molecular weight | 294.13 g/mol |
| IUPAC name | methyl 4-fluoro-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | DRYMURGWBFWGPH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2F)C)C(=O)OC |
Computed by PubChem (NCBI)