CAS 27023-05-8 appears in our catalog under these names: Methyl 4-hydroxy-2,5-dimethylbenzoate, 95%, Methyl 4-Hydroxy-2,5-dimethylbenzoate, Methyl 4–hydroxy–2,5–dimethylbenzoate, Methyl 4-hydroxy-2,5-dimethylbenzoate, ≥95%. Offered by: Combi-blocks, TRC, AmBeed, GLPBio, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 50mg.
Methyl 4-hydroxy-2,5-dimethylbenzoate (CAS 27023-05-8) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: methyl 4-hydroxy-2,5-dimethylbenzoate. InChIKey: VZEFUBJGXCSOBD-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | methyl 4-hydroxy-2,5-dimethylbenzoate |
| InChIKey | VZEFUBJGXCSOBD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1O)C)C(=O)OC |
Computed by PubChem (NCBI)