cas: 917392-54-2 — see every product listed under this CAS number, including other names
Methyl 4-methyl-3-((4-(pyridin-3-yl)pyrimidin-2-yl)amino)benzoate 95% (CAS 917392-54-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A558694-100mg |
| cas | 917392-54-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 431.56 Pln | |
| Ambeed | 250mg | 581.75 Pln | |
| Ambeed | 1g | 1633.06 Pln | |
| Ambeed | 5g | 5298.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A558694 |
Methyl 4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]benzoate (CAS 917392-54-2) is a chemical compound with the molecular formula C18H16N4O2 and a molecular weight of 320.3 g/mol. IUPAC name: methyl 4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]benzoate. InChIKey: BECBKQYLJDEVDN-UHFFFAOYSA-N.
| Molecular formula | C18H16N4O2 |
|---|---|
| Molecular weight | 320.3 g/mol |
| IUPAC name | methyl 4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]benzoate |
| InChIKey | BECBKQYLJDEVDN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)OC)NC2=NC=CC(=N2)C3=CN=CC=C3 |
Computed by PubChem (NCBI)