cas: 929524-50-5 — see every product listed under this CAS number, including other names
Methyl 5-amino-2-bromo-4-chlorobenzoate 98% (CAS 929524-50-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A706751-1g |
| cas | 929524-50-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 464.94 Pln | |
| Ambeed | 10g | 698.56 Pln | |
| Ambeed | 25g | 1327.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A706751 |
Methyl 5-amino-2-bromo-4-chlorobenzoate (CAS 929524-50-5) is a chemical compound with the molecular formula C8H7BrClNO2 and a molecular weight of 264.50 g/mol. IUPAC name: methyl 5-amino-2-bromo-4-chlorobenzoate. InChIKey: XUZCITBAERDTOB-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClNO2 |
|---|---|
| Molecular weight | 264.50 g/mol |
| IUPAC name | methyl 5-amino-2-bromo-4-chlorobenzoate |
| InChIKey | XUZCITBAERDTOB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1Br)Cl)N |
Computed by PubChem (NCBI)