Products 126613-10-3

CAS 126613-10-3 is the registry number for Methyl 6-(((trifluoromethyl)sulfonyl)oxy)-2-naphthoate, 98%. Offered by: Ambeed. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 6-(trifluoromethylsulfonyloxy)naphthalene-2-carboxylate (CAS 126613-10-3) is a chemical compound with the molecular formula C13H9F3O5S and a molecular weight of 334.27 g/mol. IUPAC name: methyl 6-(trifluoromethylsulfonyloxy)naphthalene-2-carboxylate. InChIKey: FFWRRNMOWZABTO-UHFFFAOYSA-N.

Identity
Molecular formulaC13H9F3O5S
Molecular weight334.27 g/mol
IUPAC namemethyl 6-(trifluoromethylsulfonyloxy)naphthalene-2-carboxylate
InChIKeyFFWRRNMOWZABTO-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC2=C(C=C1)C=C(C=C2)OS(=O)(=O)C(F)(F)F

Computed by PubChem (NCBI)