cas: 856211-63-7 — see every product listed under this CAS number, including other names
Methyl 6-amino-5-chloronicotinate, 98% (CAS 856211-63-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F322588-1G |
| cas | 856211-63-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 456.11 Pln | |
| Fluorochem | 5g | 1309.97 Pln | |
| Fluorochem | 10g | 2231.52 Pln | |
| Fluorochem | 25g | 4610.89 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 6-amino-5-chloropyridine-3-carboxylate (CAS 856211-63-7) is a chemical compound with the molecular formula C7H7ClN2O2 and a molecular weight of 186.59 g/mol. IUPAC name: methyl 6-amino-5-chloropyridine-3-carboxylate. InChIKey: CCRGDNPQASGGAX-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O2 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | methyl 6-amino-5-chloropyridine-3-carboxylate |
| InChIKey | CCRGDNPQASGGAX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(N=C1)N)Cl |
Computed by PubChem (NCBI)