Methyl N-[(4,6-dichloro-5-fluoro-3-pyridinyl)carbonyl]carbamimidothioate, 97%
cas: 2765352-59-6 — see every product listed under this CAS number, including other names
Methyl N-[(4,6-dichloro-5-fluoro-3-pyridinyl)carbonyl]carbamimidothioate, 97% (CAS 2765352-59-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch13EUBD-100mg |
| cas | 2765352-59-6 |
| size | 100mg |
| availability | 900g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 472.40 Pln | |
| Chemat | 10g | 750.80 Pln | |
| Chemat | 25g | 1437.20 Pln | |
| Chemat | 50g | 2210.00 Pln | |
| Chemat | 100g | 3726.80 Pln | |
| Fluorochem | 5g | 612.30 Pln | |
| Fluorochem | 10g | 976.76 Pln | |
| Fluorochem | 25g | 1872.28 Pln | |
| Fluorochem | 50g | 2913.58 Pln | |
| Fluorochem | 100g | 4866.01 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl N-(4,6-dichloro-5-fluoropyridine-3-carbonyl)carbamimidothioate (CAS 2765352-59-6) is a chemical compound with the molecular formula C8H6Cl2FN3OS and a molecular weight of 282.12 g/mol. IUPAC name: methyl N-(4,6-dichloro-5-fluoropyridine-3-carbonyl)carbamimidothioate. InChIKey: OOJJVVXYUYQSOL-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2FN3OS |
|---|---|
| Molecular weight | 282.12 g/mol |
| IUPAC name | methyl N-(4,6-dichloro-5-fluoropyridine-3-carbonyl)carbamimidothioate |
| InChIKey | OOJJVVXYUYQSOL-UHFFFAOYSA-N |
| SMILES | CSC(=N)NC(=O)C1=CN=C(C(=C1Cl)F)Cl |
Computed by PubChem (NCBI)