cas: 1779447-03-8 — see every product listed under this CAS number, including other names
Methyl6-fluoroindoline-2-carboxylate, 97% (CAS 1779447-03-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F719486-100MG |
| cas | 1779447-03-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 544.62 Pln | |
| Fluorochem | 250mg | 877.83 Pln | |
| Fluorochem | 500mg | 1226.67 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 6-fluoro-2,3-dihydro-1H-indole-2-carboxylate (CAS 1779447-03-8) is a chemical compound with the molecular formula C10H10FNO2 and a molecular weight of 195.19 g/mol. IUPAC name: methyl 6-fluoro-2,3-dihydro-1H-indole-2-carboxylate. InChIKey: TVVUNKCOKJKNIJ-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO2 |
|---|---|
| Molecular weight | 195.19 g/mol |
| IUPAC name | methyl 6-fluoro-2,3-dihydro-1H-indole-2-carboxylate |
| InChIKey | TVVUNKCOKJKNIJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC2=C(N1)C=C(C=C2)F |
Computed by PubChem (NCBI)