Monomethyl auristatin E, 98%
cas: 474645-27-7 — see every product listed under this CAS number, including other names
Monomethyl auristatin E, 98% (CAS 474645-27-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 1mg, 25mg. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F786682-100MG |
| cas | 474645-27-7 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 351.98 Pln | |
| Fluorochem | 250mg | 497.76 Pln | |
| Fluorochem | 1g | 1388.07 Pln | |
| Ambeed | 250mg | 520.56 Pln | |
| Ambeed | 1g | 1338.25 Pln | |
| Ambeed | 5g | 4681.31 Pln | |
| Ambeed | 10g | 7907.56 Pln | |
| Ambeed | 25g | 15745.12 Pln | |
| Chemat | 1mg | 88.40 Pln | |
| Chemat | 25mg | 146.00 Pln | |
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 285.20 Pln | |
| Chemat | 1g | 611.60 Pln | |
| Chemat | 5g | 2474.00 Pln | |
| Chemat | 10g | 4749.20 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(2S)-N-[(2S)-1-[[(3R,4S,5S)-1-[(2S)-2-[(1R,2R)-3-[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]amino]-1-methoxy-2-methyl-3-oxopropyl]pyrrolidin-1-yl]-3-methoxy-5-methyl-1-oxoheptan-4-yl]-methylamino]-3-methyl-1-oxobutan-2-yl]-3-methyl-2-(methylamino)butanamide (CAS 474645-27-7) is a chemical compound with the molecular formula C39H67N5O7 and a molecular weight of 718.0 g/mol. IUPAC name: (2S)-N-[(2S)-1-[[(3R,4S,5S)-1-[(2S)-2-[(1R,2R)-3-[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]amino]-1-methoxy-2-methyl-3-oxopropyl]pyrrolidin-1-yl]-3-methoxy-5-methyl-1-oxoheptan-4-yl]-methylamino]-3-methyl-1-oxobutan-2-yl]-3-methyl-2-(methylamino)butanamide. InChIKey: DASWEROEPLKSEI-UIJRFTGLSA-N.
| Molecular formula | C39H67N5O7 |
|---|---|
| Molecular weight | 718.0 g/mol |
| IUPAC name | (2S)-N-[(2S)-1-[[(3R,4S,5S)-1-[(2S)-2-[(1R,2R)-3-[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]amino]-1-methoxy-2-methyl-3-oxopropyl]pyrrolidin-1-yl]-3-methoxy-5-methyl-1-oxoheptan-4-yl]-methylamino]-3-methyl-1-oxobutan-2-yl]-3-methyl-2-(methylamino)butanamide |
| InChIKey | DASWEROEPLKSEI-UIJRFTGLSA-N |
| SMILES | CC[C@H](C)[C@@H]([C@@H](CC(=O)N1CCC[C@H]1[C@@H]([C@@H](C)C(=O)N[C@H](C)[C@H](C2=CC=CC=C2)O)OC)OC)N(C)C(=O)[C@H](C(C)C)NC(=O)[C@H](C(C)C)NC |
Computed by PubChem (NCBI)