cas: 1036991-25-9 — see every product listed under this CAS number, including other names
Morpholino(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanone, 98%, 98% (CAS 1036991-25-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11018I-100mg |
| cas | 1036991-25-9 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 390.80 Pln | |
| Chemat | 25g | 1485.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Morpholin-4-yl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone (CAS 1036991-25-9) is a chemical compound with the molecular formula C17H24BNO4 and a molecular weight of 317.2 g/mol. IUPAC name: morpholin-4-yl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone. InChIKey: PKONGXZPUDFPPH-UHFFFAOYSA-N.
| Molecular formula | C17H24BNO4 |
|---|---|
| Molecular weight | 317.2 g/mol |
| IUPAC name | morpholin-4-yl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone |
| InChIKey | PKONGXZPUDFPPH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(=O)N3CCOCC3 |
Computed by PubChem (NCBI)