cas: 656239-38-2 — see every product listed under this CAS number, including other names
Morpholino(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanone, 98%, 98% (CAS 656239-38-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1144TV-100mg |
| cas | 656239-38-2 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 251.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Morpholin-4-yl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone (CAS 656239-38-2) is a chemical compound with the molecular formula C17H24BNO4 and a molecular weight of 317.2 g/mol. IUPAC name: morpholin-4-yl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone. InChIKey: ZOPBEWUNCNLYSD-UHFFFAOYSA-N.
| Molecular formula | C17H24BNO4 |
|---|---|
| Molecular weight | 317.2 g/mol |
| IUPAC name | morpholin-4-yl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone |
| InChIKey | ZOPBEWUNCNLYSD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)N3CCOCC3 |
Computed by PubChem (NCBI)